Structure of PDB 3uv7 Chain A Binding Site BS02 |
|
|
Ligand ID | 0CN |
InChI | InChI=1S/C4H8O7P2/c1-2-3-4-10-13(8,9)11-12(5,6)7/h3H,1,4H2,(H,8,9)(H2,5,6,7) |
InChIKey | SBJIRHJBHHXSDO-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C=C=CCOP(=O)(O)OP(=O)(O)O | CACTVS 3.370 | O[P](O)(=O)O[P](O)(=O)OC[CH]=[C]=[CH2] | ACDLabs 12.01 | O=P(O)(O)OP(=O)(OC\C=C=C)O |
|
Formula | C4 H8 O7 P2 |
Name | buta-2,3-dien-1-yl trihydrogen diphosphate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000098207791
|
PDB chain | 3uv7 Chain A Residue 318
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.17.7.4: 4-hydroxy-3-methylbut-2-enyl diphosphate reductase. |
|
|
|