Structure of PDB 3uua Chain A Binding Site BS02 |
|
|
Ligand ID | 0CZ |
InChI | InChI=1S/C15H10F6O2/c16-14(17,18)13(15(19,20)21,9-1-5-11(22)6-2-9)10-3-7-12(23)8-4-10/h1-8,22-23H |
InChIKey | ZFVMWEVVKGLCIJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | Oc1ccc(cc1)C(c2ccc(O)cc2)(C(F)(F)F)C(F)(F)F | ACDLabs 12.01 | FC(F)(F)C(c1ccc(O)cc1)(c2ccc(O)cc2)C(F)(F)F | OpenEye OEToolkits 1.7.6 | c1cc(ccc1C(c2ccc(cc2)O)(C(F)(F)F)C(F)(F)F)O |
|
Formula | C15 H10 F6 O2 |
Name | 4,4'-(1,1,1,3,3,3-hexafluoropropane-2,2-diyl)diphenol; BISPHENOL AF |
ChEMBL | CHEMBL1900054 |
DrugBank | |
ZINC | ZINC000000043843
|
PDB chain | 3uua Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|