Structure of PDB 3u7m Chain A Binding Site BS02 |
|
|
Ligand ID | FHF |
InChI | InChI=1S/C19H28FN3O4/c1-4-5-8-14(11-23(27)12-24)18(25)17(13(2)3)22-19(26)21-16-10-7-6-9-15(16)20/h6-7,9-10,12-14,17,27H,4-5,8,11H2,1-3H3,(H2,21,22,26)/t14-,17+/m1/s1 |
InChIKey | OWFALUNDSZEADU-PBHICJAKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | CCCCC(CN(C=O)O)C(=O)C(C(C)C)NC(=O)Nc1ccccc1F | ACDLabs 12.01 | O=C(Nc1ccccc1F)NC(C(=O)C(CCCC)CN(O)C=O)C(C)C | CACTVS 3.370 | CCCC[C@H](CN(O)C=O)C(=O)[C@@H](NC(=O)Nc1ccccc1F)C(C)C | OpenEye OEToolkits 1.7.2 | CCCC[C@H](CN(C=O)O)C(=O)[C@H](C(C)C)NC(=O)Nc1ccccc1F | CACTVS 3.370 | CCCC[CH](CN(O)C=O)C(=O)[CH](NC(=O)Nc1ccccc1F)C(C)C |
|
Formula | C19 H28 F N3 O4 |
Name | N-((2R,4S)-2-butyl-4-(3-(2-fluorophenyl)ureido)-5-methyl-3-oxohexyl)-N-hydroxyformamide |
ChEMBL | CHEMBL1643878 |
DrugBank | |
ZINC | ZINC000043154485
|
PDB chain | 3u7m Chain A Residue 192
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|