Structure of PDB 3u7l Chain A Binding Site BS02 |
|
|
Ligand ID | UDB |
InChI | InChI=1S/C21H30F2N4O4/c1-21(2,3)18(25-20(30)24-16-9-14(22)8-15(23)10-16)19(29)27(12-17(28)26-31)11-13-6-4-5-7-13/h8-10,13,18,31H,4-7,11-12H2,1-3H3,(H,26,28)(H2,24,25,30)/t18-/m1/s1 |
InChIKey | AJAVBMXPKQJMJH-GOSISDBHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | CC(C)(C)C(C(=O)N(CC1CCCC1)CC(=O)NO)NC(=O)Nc2cc(cc(c2)F)F | CACTVS 3.370 | CC(C)(C)[C@H](NC(=O)Nc1cc(F)cc(F)c1)C(=O)N(CC2CCCC2)CC(=O)NO | CACTVS 3.370 | CC(C)(C)[CH](NC(=O)Nc1cc(F)cc(F)c1)C(=O)N(CC2CCCC2)CC(=O)NO | OpenEye OEToolkits 1.7.2 | CC(C)(C)[C@@H](C(=O)N(CC1CCCC1)CC(=O)NO)NC(=O)Nc2cc(cc(c2)F)F | ACDLabs 12.01 | Fc1cc(cc(F)c1)NC(=O)NC(C(=O)N(CC(=O)NO)CC2CCCC2)C(C)(C)C |
|
Formula | C21 H30 F2 N4 O4 |
Name | (S)-N-(cyclopentylmethyl)-2-(3-(3,5-difluorophenyl)ureido)-N-(2-(hydroxyamino)-2-oxoethyl)-3,3-dimethylbutanamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000069059999
|
PDB chain | 3u7l Chain A Residue 192
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|