Structure of PDB 3td8 Chain A Binding Site BS02 |
|
|
Ligand ID | D2R |
InChI | InChI=1S/C22H23N5O3/c1-13-16(12-25-21-19(13)20(23)26-22(24)27-21)10-15-11-17(30-2)9-8-14(15)6-4-3-5-7-18(28)29/h8-9,11-12H,3,5,7,10H2,1-2H3,(H,28,29)(H4,23,24,25,26,27) |
InChIKey | MAWHZPJVFGJFTF-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(O)CCCC#Cc1ccc(OC)cc1Cc2c(c3c(nc2)nc(nc3N)N)C | CACTVS 3.370 | COc1ccc(C#CCCCC(O)=O)c(Cc2cnc3nc(N)nc(N)c3c2C)c1 | OpenEye OEToolkits 1.7.2 | Cc1c(cnc2c1c(nc(n2)N)N)Cc3cc(ccc3C#CCCCC(=O)O)OC |
|
Formula | C22 H23 N5 O3 |
Name | 6-{2-[(2,4-diamino-5-methylpyrido[2,3-d]pyrimidin-6-yl)methyl]-4-methoxyphenyl}hex-5-ynoic acid; 2,4-Diamino--5-methyl-6-[2'-(4-carboxy-1-pentynyl)-5'-methoxybenzyl]pyrido[2,3-d]pyrimidine |
ChEMBL | CHEMBL187595 |
DrugBank | |
ZINC | ZINC000013646382
|
PDB chain | 3td8 Chain A Residue 302
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
L25 E32 |
Catalytic site (residue number reindexed from 1) |
L21 E28 |
Enzyme Commision number |
1.5.1.3: dihydrofolate reductase. |
|
|
|