Structure of PDB 3t6y Chain A Binding Site BS02 |
|
|
Ligand ID | DU2 |
InChI | InChI=1S/C20H23N5O4/c1-24-10-8-21-19(24)18(13-5-3-2-4-6-13)22-12-15-14(26)11-17(29-15)25-9-7-16(27)23-20(25)28/h2-10,14-15,17-18,22,26H,11-12H2,1H3,(H,23,27,28)/t14-,15+,17+,18?/m0/s1 |
InChIKey | KPWKGDCQLFIJMC-URHIDPGUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | Cn1ccnc1C(c2ccccc2)NCC3C(CC(O3)N4C=CC(=O)NC4=O)O | CACTVS 3.370 | Cn1ccnc1[C@H](NC[C@H]2O[C@H](C[C@@H]2O)N3C=CC(=O)NC3=O)c4ccccc4 | ACDLabs 12.01 | O=C1NC(=O)N(C=C1)C2OC(C(O)C2)CNC(c3ccccc3)c4nccn4C | OpenEye OEToolkits 1.7.2 | Cn1ccnc1C(c2ccccc2)NC[C@@H]3[C@H](C[C@@H](O3)N4C=CC(=O)NC4=O)O | CACTVS 3.370 | Cn1ccnc1[CH](NC[CH]2O[CH](C[CH]2O)N3C=CC(=O)NC3=O)c4ccccc4 |
|
Formula | C20 H23 N5 O4 |
Name | 2',5'-dideoxy-5'-{[(R)-(1-methyl-1H-imidazol-2-yl)(phenyl)methyl]amino}uridine |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 3t6y Chain A Residue 400
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|