Structure of PDB 3t64 Chain A Binding Site BS02 |
|
|
Ligand ID | DU3 |
InChI | InChI=1S/C22H23N3O4/c26-17-13-20(25-12-11-19(27)24-22(25)28)29-18(17)14-23-21(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-12,17-18,20-21,23,26H,13-14H2,(H,24,27,28)/t17-,18+,20+/m0/s1 |
InChIKey | JJVBLAPDVHVENR-NLWGTHIKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | c1ccc(cc1)C(c2ccccc2)NC[C@@H]3[C@H](C[C@@H](O3)N4C=CC(=O)NC4=O)O | CACTVS 3.370 | O[CH]1C[CH](O[CH]1CNC(c2ccccc2)c3ccccc3)N4C=CC(=O)NC4=O | ACDLabs 12.01 | O=C1NC(=O)N(C=C1)C2OC(C(O)C2)CNC(c3ccccc3)c4ccccc4 | CACTVS 3.370 | O[C@H]1C[C@@H](O[C@@H]1CNC(c2ccccc2)c3ccccc3)N4C=CC(=O)NC4=O | OpenEye OEToolkits 1.7.2 | c1ccc(cc1)C(c2ccccc2)NCC3C(CC(O3)N4C=CC(=O)NC4=O)O |
|
Formula | C22 H23 N3 O4 |
Name | 2',5'-dideoxy-5'-[(diphenylmethyl)amino]uridine |
ChEMBL | CHEMBL2420340 |
DrugBank | |
ZINC | ZINC000095920839
|
PDB chain | 3t64 Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|