Structure of PDB 3t60 Chain A Binding Site BS02 |
|
|
Ligand ID | DUA |
InChI | InChI=1S/C28H27N3O4/c32-23-18-26(31-17-16-25(33)30-27(31)34)35-24(23)19-29-28(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-17,23-24,26,29,32H,18-19H2,(H,30,33,34)/t23-,24+,26+/m0/s1 |
InChIKey | TUZNCXRMWDUVNX-BFLUCZKCSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | O[C@H]1C[C@@H](O[C@@H]1CNC(c2ccccc2)(c3ccccc3)c4ccccc4)N5C=CC(=O)NC5=O | OpenEye OEToolkits 1.7.2 | c1ccc(cc1)C(c2ccccc2)(c3ccccc3)NCC4C(CC(O4)N5C=CC(=O)NC5=O)O | CACTVS 3.370 | O[CH]1C[CH](O[CH]1CNC(c2ccccc2)(c3ccccc3)c4ccccc4)N5C=CC(=O)NC5=O | OpenEye OEToolkits 1.7.2 | c1ccc(cc1)C(c2ccccc2)(c3ccccc3)NC[C@@H]4[C@H](C[C@@H](O4)N5C=CC(=O)NC5=O)O | ACDLabs 12.01 | O=C1NC(=O)N(C=C1)C2OC(C(O)C2)CNC(c3ccccc3)(c4ccccc4)c5ccccc5 |
|
Formula | C28 H27 N3 O4 |
Name | 2',5'-dideoxy-5'-(tritylamino)uridine |
ChEMBL | CHEMBL377582 |
DrugBank | |
ZINC | ZINC000013673354
|
PDB chain | 3t60 Chain C Residue 182
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|