Structure of PDB 3sm0 Chain A Binding Site BS02 |
|
|
Ligand ID | AEK |
InChI | InChI=1S/C18H24N6O/c1-19-18-23-14-8-13-15(21-10-22-17(13)25)12(16(14)24-18)6-7-20-9-11-4-2-3-5-11/h8,10-11,20H,2-7,9H2,1H3,(H2,19,23,24)(H,21,22,25) |
InChIKey | IEHXPXUWCFKZTR-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CNc1[nH]c2c(CCNCC3CCCC3)c4N=CNC(=O)c4cc2n1 | OpenEye OEToolkits 1.7.2 | CNc1[nH]c2c(n1)cc3c(c2CCNCC4CCCC4)N=CNC3=O | ACDLabs 12.01 | O=C2c3cc1nc(NC)nc1c(c3N=CN2)CCNCC4CCCC4 |
|
Formula | C18 H24 N6 O |
Name | 4-{2-[(cyclopentylmethyl)amino]ethyl}-2-(methylamino)-3,7-dihydro-8H-imidazo[4,5-g]quinazolin-8-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921405
|
PDB chain | 3sm0 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|