Structure of PDB 3sl6 Chain A Binding Site BS02 |
|
|
Ligand ID | JN8 |
InChI | InChI=1S/C22H27N3O4S2/c1-2-23-22(28)25-10-9-16-17(13-25)31-20(24-18(26)12-15-8-5-11-30-15)19(16)21(27)29-14-6-3-4-7-14/h5,8,11,14H,2-4,6-7,9-10,12-13H2,1H3,(H,23,28)(H,24,26) |
InChIKey | TWWIEHZKMVMPFQ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CCNC(=O)N1CCc2c(C1)sc(NC(=O)Cc3sccc3)c2C(=O)OC4CCCC4 | ACDLabs 12.01 | O=C(OC1CCCC1)c2c4c(sc2NC(=O)Cc3sccc3)CN(C(=O)NCC)CC4 | OpenEye OEToolkits 1.7.2 | CCNC(=O)N1CCc2c(sc(c2C(=O)OC3CCCC3)NC(=O)Cc4cccs4)C1 |
|
Formula | C22 H27 N3 O4 S2 |
Name | cyclopentyl 6-(ethylcarbamoyl)-2-[(thiophen-2-ylacetyl)amino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylate |
ChEMBL | CHEMBL1923065 |
DrugBank | |
ZINC | ZINC000073196356
|
PDB chain | 3sl6 Chain A Residue 440
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.4.53: 3',5'-cyclic-AMP phosphodiesterase. |
|
|
|