Structure of PDB 3s9u Chain A Binding Site BS02 |
|
|
Ligand ID | 5DR |
InChI | InChI=1S/C22H22N4O/c1-3-19-18(21(23)26-22(24)25-19)11-7-10-17-14-16(12-13-20(17)27-2)15-8-5-4-6-9-15/h4-6,8-9,12-14H,3,10H2,1-2H3,(H4,23,24,25,26) |
InChIKey | LBQMRSNKEUNXMT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | CCc1c(c(nc(n1)N)N)C#CCc2cc(ccc2OC)c3ccccc3 | ACDLabs 12.01 | n3c(c(C#CCc2cc(c1ccccc1)ccc2OC)c(nc3N)N)CC | CACTVS 3.370 | CCc1nc(N)nc(N)c1C#CCc2cc(ccc2OC)c3ccccc3 |
|
Formula | C22 H22 N4 O |
Name | 6-ethyl-5-[3-(4-methoxybiphenyl-3-yl)prop-1-yn-1-yl]pyrimidine-2,4-diamine |
ChEMBL | CHEMBL1270533 |
DrugBank | |
ZINC | ZINC000064528196
|
PDB chain | 3s9u Chain A Residue 163
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|