Structure of PDB 3s9s Chain A Binding Site BS02 |
|
|
Ligand ID | M0T |
InChI | InChI=1S/C25H23Cl2N3O/c1-3-22(18-7-5-4-6-8-18)29-25(31)19-10-12-24-23(14-19)28-16(2)30(24)15-17-9-11-20(26)21(27)13-17/h4-14,22H,3,15H2,1-2H3,(H,29,31)/t22-/m1/s1 |
InChIKey | LDYDIGPGIRJQAU-JOCHJYFZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | CCC(c1ccccc1)NC(=O)c2ccc3c(c2)nc(n3Cc4ccc(c(c4)Cl)Cl)C | OpenEye OEToolkits 1.7.0 | CC[C@H](c1ccccc1)NC(=O)c2ccc3c(c2)nc(n3Cc4ccc(c(c4)Cl)Cl)C | CACTVS 3.370 | CC[C@@H](NC(=O)c1ccc2n(Cc3ccc(Cl)c(Cl)c3)c(C)nc2c1)c4ccccc4 | ACDLabs 12.01 | Clc1ccc(cc1Cl)Cn2c3ccc(cc3nc2C)C(=O)NC(c4ccccc4)CC | CACTVS 3.370 | CC[CH](NC(=O)c1ccc2n(Cc3ccc(Cl)c(Cl)c3)c(C)nc2c1)c4ccccc4 |
|
Formula | C25 H23 Cl2 N3 O |
Name | 1-(3,4-dichlorobenzyl)-2-methyl-N-[(1R)-1-phenylpropyl]-1H-benzimidazole-5-carboxamide |
ChEMBL | CHEMBL1825106 |
DrugBank | |
ZINC | ZINC000072182088
|
PDB chain | 3s9s Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|