Structure of PDB 3s7s Chain A Binding Site BS02 |
|
|
Ligand ID | EXM |
InChI | InChI=1S/C20H24O2/c1-12-10-14-15-4-5-18(22)20(15,3)9-7-16(14)19(2)8-6-13(21)11-17(12)19/h6,8,11,14-16H,1,4-5,7,9-10H2,2-3H3/t14-,15-,16-,19+,20-/m0/s1 |
InChIKey | BFYIZQONLCFLEV-DAELLWKTSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | CC12CCC3C(C1CCC2=O)CC(=C)C4=CC(=O)C=CC34C | ACDLabs 12.01 | O=C2C=C1\C(=C)CC3C(C1(C=C2)C)CCC4(C(=O)CCC34)C | OpenEye OEToolkits 1.7.2 | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CC(=C)C4=CC(=O)C=C[C@]34C | CACTVS 3.370 | C[C]12CC[CH]3[CH](CC(=C)C4=CC(=O)C=C[C]34C)[CH]1CCC2=O | CACTVS 3.370 | C[C@]12CC[C@H]3[C@@H](CC(=C)C4=CC(=O)C=C[C@]34C)[C@@H]1CCC2=O |
|
Formula | C20 H24 O2 |
Name | (8alpha,10alpha,13alpha)-6-methylideneandrosta-1,4-diene-3,17-dione; Exemestane; aromasin |
ChEMBL | CHEMBL1200374 |
DrugBank | DB00990 |
ZINC | ZINC000003973334
|
PDB chain | 3s7s Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|