Structure of PDB 3rz8 Chain A Binding Site BS02 |
|
|
Ligand ID | RZ8 |
InChI | InChI=1S/C13H20N2O3S/c1-2-3-4-5-10-15-13(16)11-6-8-12(9-7-11)19(14,17)18/h6-9H,2-5,10H2,1H3,(H,15,16)(H2,14,17,18) |
InChIKey | KLHBIQFDNTURJX-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CCCCCCNC(=O)c1ccc(cc1)[S](N)(=O)=O | OpenEye OEToolkits 1.7.2 | CCCCCCNC(=O)c1ccc(cc1)S(=O)(=O)N | ACDLabs 12.01 | O=S(=O)(N)c1ccc(C(=O)NCCCCCC)cc1 |
|
Formula | C13 H20 N2 O3 S |
Name | N-hexyl-4-sulfamoylbenzamide |
ChEMBL | CHEMBL72963 |
DrugBank | |
ZINC | ZINC000013603120
|
PDB chain | 3rz8 Chain A Residue 262
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|