Structure of PDB 3ryz Chain A Binding Site BS02 |
|
|
Ligand ID | RYZ |
InChI | InChI=1S/C11H9F7N2O3S/c12-9(13,10(14,15)11(16,17)18)5-20-8(21)6-1-3-7(4-2-6)24(19,22)23/h1-4H,5H2,(H,20,21)(H2,19,22,23) |
InChIKey | NITAUHAUSHVTPT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | N[S](=O)(=O)c1ccc(cc1)C(=O)NCC(F)(F)C(F)(F)C(F)(F)F | OpenEye OEToolkits 1.7.2 | c1cc(ccc1C(=O)NCC(C(C(F)(F)F)(F)F)(F)F)S(=O)(=O)N | ACDLabs 12.01 | O=S(=O)(N)c1ccc(C(=O)NCC(F)(F)C(F)(F)C(F)(F)F)cc1 |
|
Formula | C11 H9 F7 N2 O3 S |
Name | N-(2,2,3,3,4,4,4-heptafluorobutyl)-4-sulfamoylbenzamide |
ChEMBL | CHEMBL309012 |
DrugBank | |
ZINC | ZINC000013603129
|
PDB chain | 3ryz Chain A Residue 262
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|