Structure of PDB 3ryy Chain A Binding Site BS02 |
|
|
Ligand ID | RYY |
InChI | InChI=1S/C10H14N2O3S/c1-2-7-12-10(13)8-3-5-9(6-4-8)16(11,14)15/h3-6H,2,7H2,1H3,(H,12,13)(H2,11,14,15) |
InChIKey | YWNDDZRHHBUBPB-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CCCNC(=O)c1ccc(cc1)[S](N)(=O)=O | ACDLabs 12.01 | O=S(=O)(N)c1ccc(C(=O)NCCC)cc1 | OpenEye OEToolkits 1.7.2 | CCCNC(=O)c1ccc(cc1)S(=O)(=O)N |
|
Formula | C10 H14 N2 O3 S |
Name | N-propyl-4-sulfamoylbenzamide |
ChEMBL | CHEMBL74090 |
DrugBank | |
ZINC | ZINC000001748006
|
PDB chain | 3ryy Chain A Residue 262
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|