Structure of PDB 3rr4 Chain A Binding Site BS02 |
|
|
Ligand ID | HRD |
InChI | InChI=1S/C11H12N6O/c1-12-10-15-7-3-5-6(4-8(7)16-10)14-11(13-2)17-9(5)18/h3-4H,1-2H3,(H2,12,15,16)(H2,13,14,17,18) |
InChIKey | YOTQNVNIJNKFAK-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CNC1=Nc2cc3nc(NC)[nH]c3cc2C(=O)N1 | OpenEye OEToolkits 1.7.2 | CNc1[nH]c2cc3c(cc2n1)N=C(NC3=O)NC | ACDLabs 12.01 | O=C2c3cc1nc(nc1cc3N=C(NC)N2)NC |
|
Formula | C11 H12 N6 O |
Name | 2,6-bis(methylamino)-1,7-dihydro-8H-imidazo[4,5-g]quinazolin-8-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921287
|
PDB chain | 3rr4 Chain A Residue 501
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|