Structure of PDB 3roa Chain A Binding Site BS02 |
|
|
Ligand ID | 06V |
InChI | InChI=1S/C21H27N5O2/c1-4-19-18(20(22)25-21(23)24-19)6-5-14(2)15-11-16(13-17(12-15)27-3)26-7-9-28-10-8-26/h11-14H,4,7-10H2,1-3H3,(H4,22,23,24,25)/t14-/m0/s1 |
InChIKey | DNZHKQMESCYJCG-AWEZNQCLSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CCc1nc(N)nc(N)c1C#C[C@H](C)c2cc(OC)cc(c2)N3CCOCC3 | CACTVS 3.370 | CCc1nc(N)nc(N)c1C#C[CH](C)c2cc(OC)cc(c2)N3CCOCC3 | OpenEye OEToolkits 1.7.2 | CCc1c(c(nc(n1)N)N)C#CC(C)c2cc(cc(c2)OC)N3CCOCC3 | OpenEye OEToolkits 1.7.2 | CCc1c(c(nc(n1)N)N)C#C[C@H](C)c2cc(cc(c2)OC)N3CCOCC3 | ACDLabs 12.01 | n3c(c(C#CC(c1cc(cc(OC)c1)N2CCOCC2)C)c(nc3N)N)CC |
|
Formula | C21 H27 N5 O2 |
Name | 6-ethyl-5-{(3R)-3-[3-methoxy-5-(morpholin-4-yl)phenyl]but-1-yn-1-yl}pyrimidine-2,4-diamine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095589465
|
PDB chain | 3roa Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|