Structure of PDB 3r0i Chain A Binding Site BS02 |
|
|
Ligand ID | C0K |
InChI | InChI=1S/C11H14F2NO5P/c1-14(16)11(15)5-4-10(20(17,18)19)7-2-3-8(12)9(13)6-7/h2-3,6,10,16H,4-5H2,1H3,(H2,17,18,19)/t10-/m0/s1 |
InChIKey | IZWIBRNXHRUNKD-JTQLQIEISA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CN(O)C(=O)CC[C@@H](c1ccc(F)c(F)c1)[P](O)(O)=O | ACDLabs 12.01 | Fc1ccc(cc1F)C(CCC(=O)N(O)C)P(=O)(O)O | CACTVS 3.370 | CN(O)C(=O)CC[CH](c1ccc(F)c(F)c1)[P](O)(O)=O | OpenEye OEToolkits 1.7.0 | CN(C(=O)CCC(c1ccc(c(c1)F)F)P(=O)(O)O)O | OpenEye OEToolkits 1.7.0 | CN(C(=O)CC[C@@H](c1ccc(c(c1)F)F)P(=O)(O)O)O |
|
Formula | C11 H14 F2 N O5 P |
Name | {(1S)-1-(3,4-difluorophenyl)-4-[hydroxy(methyl)amino]-4-oxobutyl}phosphonic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000072116317
|
PDB chain | 3r0i Chain A Residue 991
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
1.1.1.267: 1-deoxy-D-xylulose-5-phosphate reductoisomerase. |
|
|
Biological Process |
GO:0008299 |
isoprenoid biosynthetic process |
GO:0019288 |
isopentenyl diphosphate biosynthetic process, methylerythritol 4-phosphate pathway |
GO:0051484 |
isopentenyl diphosphate biosynthetic process, methylerythritol 4-phosphate pathway involved in terpenoid biosynthetic process |
|
|