Structure of PDB 3qyk Chain A Binding Site BS02 |
|
|
Ligand ID | IE2 |
InChI | InChI=1S/C16H14N4O2S2/c1-10-2-7-14-15-11(9-23-16(14)19-10)8-18-20(15)12-3-5-13(6-4-12)24(17,21)22/h2-8H,9H2,1H3,(H2,17,21,22) |
InChIKey | BBYVQBNYXZIDGW-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | Cc1ccc-2c(n1)SCc3c2n(nc3)c4ccc(cc4)S(=O)(=O)N | CACTVS 3.370 | Cc1ccc2c(SCc3cnn(c4ccc(cc4)[S](N)(=O)=O)c23)n1 | ACDLabs 12.01 | O=S(=O)(N)c4ccc(n3ncc2c3c1c(nc(cc1)C)SC2)cc4 |
|
Formula | C16 H14 N4 O2 S2 |
Name | 4-(7-methylpyrazolo[3',4':4,5]thiopyrano[2,3-b]pyridin-1(4H)-yl)benzenesulfonamide |
ChEMBL | CHEMBL2179304 |
DrugBank | |
ZINC | ZINC000095578669
|
PDB chain | 3qyk Chain A Residue 263
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|