Structure of PDB 3qly Chain A Binding Site BS02 |
|
|
Ligand ID | 55V |
InChI | InChI=1S/C19H24N4O3/c1-11-13(17(20)23-18(21)22-11)7-8-19(2,3)12-9-14(24-4)16(26-6)15(10-12)25-5/h9-10H,1-6H3,(H4,20,21,22,23) |
InChIKey | FJNFXXGWYVMQNA-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | COc1cc(cc(OC)c1OC)C(C)(C)C#Cc2c(C)nc(N)nc2N | ACDLabs 10.04 | C(#CC(c1cc(OC)c(OC)c(OC)c1)(C)C)c2c(nc(nc2C)N)N | OpenEye OEToolkits 1.5.0 | Cc1c(c(nc(n1)N)N)C#CC(C)(C)c2cc(c(c(c2)OC)OC)OC |
|
Formula | C19 H24 N4 O3 |
Name | 6-methyl-5-[3-methyl-3-(3,4,5-trimethoxyphenyl)but-1-yn-1-yl]pyrimidine-2,4-diamine; 2,4-Diamino-5-[3-(3,4,5-trimethoxyphenyl)pent-1-ynyl]-6-methylpyrimidine |
ChEMBL | CHEMBL1230365 |
DrugBank | DB07153 |
ZINC | ZINC000053683841
|
PDB chain | 3qly Chain A Residue 229
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|