Structure of PDB 3plz Chain A Binding Site BS02 |
|
|
Ligand ID | 470 |
InChI | InChI=1S/C28H35N/c1-3-5-14-22(13-4-2)26-21-24-17-12-20-28(24,29-25-18-10-7-11-19-25)27(26)23-15-8-6-9-16-23/h6-11,14-16,18-19,24,29H,3-5,12-13,17,20-21H2,1-2H3/b22-14+/t24-,28+/m1/s1 |
InChIKey | WRZLRWJDJPFDGG-KTNSFKJWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CCCC=C(CCC)C1=C(c2ccccc2)[C]3(CCC[CH]3C1)Nc4ccccc4 | OpenEye OEToolkits 1.7.0 | CCCC=C(CCC)C1=C(C2(CCCC2C1)Nc3ccccc3)c4ccccc4 | ACDLabs 12.01 | N(c1ccccc1)C23C(=C(/C(=C/CCC)CCC)CC3CCC2)c4ccccc4 | OpenEye OEToolkits 1.7.0 | CCC/C=C(\CCC)/C1=C([C@@]2(CCC[C@@H]2C1)Nc3ccccc3)c4ccccc4 | CACTVS 3.370 | CCC\C=C(/CCC)C1=C(c2ccccc2)[C@@]3(CCC[C@@H]3C1)Nc4ccccc4 |
|
Formula | C28 H35 N |
Name | (3aS,6aR)-5-[(4E)-oct-4-en-4-yl]-N,4-diphenyl-2,3,6,6a-tetrahydropentalen-3a(1H)-amine |
ChEMBL | CHEMBL385911 |
DrugBank | |
ZINC | ZINC000014978511
|
PDB chain | 3plz Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|