Structure of PDB 3pd8 Chain A Binding Site BS02 |
|
|
Ligand ID | HA7 |
InChI | InChI=1S/C7H8N2O4/c10-6-3-1-2-8-4(7(11)12)5(3)13-9-6/h4,8H,1-2H2,(H,9,10)(H,11,12)/t4-/m0/s1 |
InChIKey | YRSIGIYXZNQZCI-BYPYZUCNSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | OC(=O)[C@H]1NCCc2c(O)noc12 | OpenEye OEToolkits 1.7.5 | C1CN[C@@H](c2c1c(no2)O)C(=O)O | OpenEye OEToolkits 1.7.5 | C1CNC(c2c1c(no2)O)C(=O)O | CACTVS 3.385 | OC(=O)[CH]1NCCc2c(O)noc12 |
|
Formula | C7 H8 N2 O4 |
Name | (7S)-3-hydroxy-4,5,6,7-tetrahydroisoxazolo[5,4-c]pyridine-7-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 3pd8 Chain A Residue 261
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|