Structure of PDB 3pcu Chain A Binding Site BS02 |
|
|
Ligand ID | LX8 |
InChI | InChI=1S/C21H24O5/c1-7-20(3,4)15-9-13-8-14-10-18(21(5,6)26-12(2)22)24-16(14)11-17(13)25-19(15)23/h7-9,11,18H,1,10H2,2-6H3/t18-/m0/s1 |
InChIKey | AWMHMGFGCLBSAY-SFHVURJKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | CC(=O)OC(C)(C)[C@@H]1Cc2cc3c(cc2O1)OC(=O)C(=C3)C(C)(C)C=C | OpenEye OEToolkits 1.7.0 | CC(=O)OC(C)(C)C1Cc2cc3c(cc2O1)OC(=O)C(=C3)C(C)(C)C=C | CACTVS 3.370 | CC(=O)OC(C)(C)[C@@H]1Cc2cc3C=C(C(=O)Oc3cc2O1)C(C)(C)C=C | ACDLabs 12.01 | O=C(OC(C)(C)C3Oc2cc1OC(=O)C(=Cc1cc2C3)C(/C=C)(C)C)C | CACTVS 3.370 | CC(=O)OC(C)(C)[CH]1Cc2cc3C=C(C(=O)Oc3cc2O1)C(C)(C)C=C |
|
Formula | C21 H24 O5 |
Name | 2-[(2S)-6-(2-methylbut-3-en-2-yl)-7-oxo-2,3-dihydro-7H-furo[3,2-g]chromen-2-yl]propan-2-yl acetate |
ChEMBL | CHEMBL3577084 |
DrugBank | |
ZINC | ZINC000001558484
|
PDB chain | 3pcu Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|