Structure of PDB 3o6i Chain A Binding Site BS02 |
|
|
Ligand ID | O26 |
InChI | InChI=1S/C20H29N5O2S/c1-20(2,3)17-12(9-22-4)10-25(24-17)11-15(26)23-19-16(18(21)27)13-7-5-6-8-14(13)28-19/h10,22H,5-9,11H2,1-4H3,(H2,21,27)(H,23,26) |
InChIKey | ORJNBGRVTFLPLF-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(c1c3c(sc1NC(=O)Cn2nc(c(c2)CNC)C(C)(C)C)CCCC3)N | CACTVS 3.370 | CNCc1cn(CC(=O)Nc2sc3CCCCc3c2C(N)=O)nc1C(C)(C)C | OpenEye OEToolkits 1.7.0 | CC(C)(C)c1c(cn(n1)CC(=O)Nc2c(c3c(s2)CCCC3)C(=O)N)CNC |
|
Formula | C20 H29 N5 O2 S |
Name | 2-[({3-tert-butyl-4-[(methylamino)methyl]-1H-pyrazol-1-yl}acetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
ChEMBL | CHEMBL1234888 |
DrugBank | |
ZINC | ZINC000058638862
|
PDB chain | 3o6i Chain A Residue 265
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|