Structure of PDB 3o6h Chain A Binding Site BS02 |
|
|
Ligand ID | O25 |
InChI | InChI=1S/C18H22F3N5O2S/c1-2-23-7-10-8-26(25-15(10)18(19,20)21)9-13(27)24-17-14(16(22)28)11-5-3-4-6-12(11)29-17/h8,23H,2-7,9H2,1H3,(H2,22,28)(H,24,27) |
InChIKey | MEANENDBNRVQSP-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | FC(F)(F)c1nn(cc1CNCC)CC(=O)Nc2sc3c(c2C(=O)N)CCCC3 | OpenEye OEToolkits 1.7.0 | CCNCc1cn(nc1C(F)(F)F)CC(=O)Nc2c(c3c(s2)CCCC3)C(=O)N | CACTVS 3.370 | CCNCc1cn(CC(=O)Nc2sc3CCCCc3c2C(N)=O)nc1C(F)(F)F |
|
Formula | C18 H22 F3 N5 O2 S |
Name | 2-[({4-[(ethylamino)methyl]-3-(trifluoromethyl)-1H-pyrazol-1-yl}acetyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
ChEMBL | CHEMBL1234887 |
DrugBank | |
ZINC | ZINC000058650638
|
PDB chain | 3o6h Chain A Residue 268
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|