Structure of PDB 3o6g Chain A Binding Site BS02 |
|
|
Ligand ID | O27 |
InChI | InChI=1S/C23H28F3N5O2S/c24-23(25,26)20-14-5-1-3-7-16(14)31(30-20)12-18(32)29-22-19(15-6-2-4-8-17(15)34-22)21(33)28-13-9-10-27-11-13/h13,27H,1-12H2,(H,28,33)(H,29,32)/t13-/m1/s1 |
InChIKey | CFYCEUGQUDABFL-CYBMUJFWSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C1CCc2c(c(nn2CC(=O)Nc3c(c4c(s3)CCCC4)C(=O)NC5CCNC5)C(F)(F)F)C1 | OpenEye OEToolkits 1.7.6 | C1CCc2c(c(nn2CC(=O)Nc3c(c4c(s3)CCCC4)C(=O)N[C@@H]5CCNC5)C(F)(F)F)C1 | ACDLabs 12.01 | FC(F)(F)c1nn(c2c1CCCC2)CC(=O)Nc3sc5c(c3C(=O)NC4CCNC4)CCCC5 | CACTVS 3.370 | FC(F)(F)c1nn(CC(=O)Nc2sc3CCCCc3c2C(=O)N[CH]4CCNC4)c5CCCCc15 | CACTVS 3.370 | FC(F)(F)c1nn(CC(=O)Nc2sc3CCCCc3c2C(=O)N[C@@H]4CCNC4)c5CCCCc15 |
|
Formula | C23 H28 F3 N5 O2 S |
Name | N-[(3R)-pyrrolidin-3-yl]-2-({[3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazol-1-yl]acetyl}amino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
ChEMBL | CHEMBL1234889 |
DrugBank | |
ZINC | ZINC000058660649
|
PDB chain | 3o6g Chain A Residue 268
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|