Structure of PDB 3nj4 Chain A Binding Site BS02 |
|
|
Ligand ID | AFX |
InChI | InChI=1S/C11H10FN5O3/c12-5-4(1-18)8(19)9(20)7(5)17-3-16-6-10(13)14-2-15-11(6)17/h2-3,7,9,18,20H,1H2,(H2,13,14,15)/t7-,9+/m1/s1 |
InChIKey | DMGPQGOOCCLGOU-APPZFPTMSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | FC1=C(C(=O)C(O)C1n2c3ncnc(c3nc2)N)CO | CACTVS 3.370 | Nc1ncnc2n(cnc12)[CH]3[CH](O)C(=O)C(=C3F)CO | OpenEye OEToolkits 1.7.0 | c1nc(c2c(n1)n(cn2)C3C(C(=O)C(=C3F)CO)O)N | OpenEye OEToolkits 1.7.0 | c1nc(c2c(n1)n(cn2)[C@H]3[C@@H](C(=O)C(=C3F)CO)O)N | CACTVS 3.370 | Nc1ncnc2n(cnc12)[C@H]3[C@H](O)C(=O)C(=C3F)CO |
|
Formula | C11 H10 F N5 O3 |
Name | (4S,5S)-4-(6-amino-9H-purin-9-yl)-3-fluoro-5-hydroxy-2-(hydroxymethyl)cyclopent-2-en-1-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000066166914
|
PDB chain | 3nj4 Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|