Structure of PDB 3nb5 Chain A Binding Site BS02 |
|
|
Ligand ID | R21 |
InChI | InChI=1S/C16H17ClN2O4S/c17-14-9-12(3-6-15(14)20)10-16(21)19-8-7-11-1-4-13(5-2-11)24(18,22)23/h1-6,9,20H,7-8,10H2,(H,19,21)(H2,18,22,23) |
InChIKey | MALIONKMKPITBV-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | N[S](=O)(=O)c1ccc(CCNC(=O)Cc2ccc(O)c(Cl)c2)cc1 | OpenEye OEToolkits 1.7.0 | c1cc(ccc1CCNC(=O)Cc2ccc(c(c2)Cl)O)S(=O)(=O)N | ACDLabs 12.01 | Clc1cc(ccc1O)CC(=O)NCCc2ccc(cc2)S(=O)(=O)N |
|
Formula | C16 H17 Cl N2 O4 S |
Name | 2-(3-chloro-4-hydroxyphenyl)-N-[2-(4-sulfamoylphenyl)ethyl]acetamide; 2-(3-chloro-4-hydroxyphenyl)-N-(4-sulfamoylphenethyl)acetamide |
ChEMBL | CHEMBL606453 |
DrugBank | |
ZINC | ZINC000035950478
|
PDB chain | 3nb5 Chain A Residue 300
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|