Structure of PDB 3mna Chain A Binding Site BS02 |
|
|
Ligand ID | DWH |
InChI | InChI=1S/C12H13ClN6O4S/c1-23-9(20)6-15-11-17-10(13)18-12(19-11)16-7-2-4-8(5-3-7)24(14,21)22/h2-5H,6H2,1H3,(H2,14,21,22)(H2,15,16,17,18,19) |
InChIKey | UKXSOQVHRHLCDQ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Clc1nc(nc(n1)NCC(=O)OC)Nc2ccc(cc2)S(=O)(=O)N | OpenEye OEToolkits 1.7.0 | COC(=O)CNc1nc(nc(n1)Cl)Nc2ccc(cc2)S(=O)(=O)N | CACTVS 3.370 | COC(=O)CNc1nc(Cl)nc(Nc2ccc(cc2)[S](N)(=O)=O)n1 |
|
Formula | C12 H13 Cl N6 O4 S |
Name | methyl N-{4-chloro-6-[(4-sulfamoylphenyl)amino]-1,3,5-triazin-2-yl}glycinate |
ChEMBL | CHEMBL1738792 |
DrugBank | |
ZINC | ZINC000066166103
|
PDB chain | 3mna Chain A Residue 263
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|