Structure of PDB 3ml2 Chain A Binding Site BS02 |
|
|
Ligand ID | SU0 |
InChI | InChI=1S/C18H16N2O6S/c1-25-13-4-7-15-11(9-18(22)26-16(15)10-13)8-17(21)20-12-2-5-14(6-3-12)27(19,23)24/h2-7,9-10H,8H2,1H3,(H,20,21)(H2,19,23,24) |
InChIKey | VZBSCWDKCMOJCR-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=S(=O)(N)c1ccc(cc1)NC(=O)CC=2c3c(OC(=O)C=2)cc(OC)cc3 | OpenEye OEToolkits 1.7.0 | COc1ccc2c(c1)OC(=O)C=C2CC(=O)Nc3ccc(cc3)S(=O)(=O)N | CACTVS 3.370 | COc1ccc2C(=CC(=O)Oc2c1)CC(=O)Nc3ccc(cc3)[S](N)(=O)=O |
|
Formula | C18 H16 N2 O6 S |
Name | 2-(7-methoxy-2-oxo-2H-chromen-4-yl)-N-(4-sulfamoylphenyl)acetamide |
ChEMBL | CHEMBL477822 |
DrugBank | |
ZINC | ZINC000009705226
|
PDB chain | 3ml2 Chain A Residue 263
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|