Structure of PDB 3m5e Chain A Binding Site BS02 |
|
|
Ligand ID | JDR |
InChI | InChI=1S/C13H13ClN4O3S2/c1-22-13-17-11(14)10(7-19)12(18-13)16-6-8-2-4-9(5-3-8)23(15,20)21/h2-5,7H,6H2,1H3,(H2,15,20,21)(H,16,17,18) |
InChIKey | NPWLBLGDDVPXFE-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CSc1nc(Cl)c(C=O)c(NCc2ccc(cc2)[S](N)(=O)=O)n1 | ACDLabs 12.01 | O=S(=O)(N)c1ccc(cc1)CNc2nc(SC)nc(Cl)c2C=O | OpenEye OEToolkits 1.7.0 | CSc1nc(c(c(n1)Cl)C=O)NCc2ccc(cc2)S(=O)(=O)N |
|
Formula | C13 H13 Cl N4 O3 S2 |
Name | 4-({[6-chloro-5-formyl-2-(methylsulfanyl)pyrimidin-4-yl]amino}methyl)benzenesulfonamide; 4-{[N-(6-chloro-5-formyl-2-methylthiopyrimidin-4-yl)amino]methyl}benzenesulfonamide |
ChEMBL | CHEMBL1233735 |
DrugBank | |
ZINC | ZINC000058649837
|
PDB chain | 3m5e Chain A Residue 264
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|