Structure of PDB 3m3x Chain A Binding Site BS02 |
|
|
Ligand ID | JS7 |
InChI | InChI=1S/C13H15N5O5S/c1-23-13-11(18(19)20)12(16-8-17-13)15-7-6-9-2-4-10(5-3-9)24(14,21)22/h2-5,8H,6-7H2,1H3,(H2,14,21,22)(H,15,16,17) |
InChIKey | ZIQFGPRCONAHFK-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | COc1ncnc(NCCc2ccc(cc2)[S](N)(=O)=O)c1[N+]([O-])=O | ACDLabs 12.01 | O=S(=O)(N)c1ccc(cc1)CCNc2ncnc(OC)c2[N+]([O-])=O | OpenEye OEToolkits 1.7.0 | COc1c(c(ncn1)NCCc2ccc(cc2)S(=O)(=O)N)[N+](=O)[O-] |
|
Formula | C13 H15 N5 O5 S |
Name | 4-{2-[(6-methoxy-5-nitropyrimidin-4-yl)amino]ethyl}benzenesulfonamide |
ChEMBL | CHEMBL1233768 |
DrugBank | |
ZINC | ZINC000058638843
|
PDB chain | 3m3x Chain A Residue 264
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|