Structure of PDB 3lx3 Chain A Binding Site BS02 |
|
|
Ligand ID | XTN |
InChI | InChI=1S/C6H5N5O2/c7-6-10-4-3(5(13)11-6)9-2(12)1-8-4/h1H,(H,9,12)(H3,7,8,10,11,13) |
InChIKey | VURKRJGMSKJIQX-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | NC1=NC(=O)C2=C(N1)N=CC(=O)N2 | ACDLabs 12.01 | O=C1C=NC2=C(N1)C(=O)N=C(N)N2 | OpenEye OEToolkits 1.7.0 | C1=NC2=C(C(=O)N=C(N2)N)NC1=O |
|
Formula | C6 H5 N5 O2 |
Name | 2-amino-1,5-dihydropteridine-4,6-dione; Xanthopterin |
ChEMBL | CHEMBL1236854 |
DrugBank | |
ZINC | ZINC000012660678
|
PDB chain | 3lx3 Chain A Residue 211
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
4.2.3.12: 6-pyruvoyltetrahydropterin synthase. |
|
|
|