Structure of PDB 3lc5 Chain A Binding Site BS02 |
|
|
Ligand ID | IZX |
InChI | InChI=1S/C24H20N4O2S/c25-22(26)20-14-17-18(12-7-13-19(17)31-20)29-21(15-8-3-1-4-9-15)24-27-23(28-30-24)16-10-5-2-6-11-16/h1-14,21-22H,25-26H2/t21-/m1/s1 |
InChIKey | VBSNODZWDZSFEZ-OAQYLSRUSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | NC(N)c1sc2cccc(O[CH](c3onc(n3)c4ccccc4)c5ccccc5)c2c1 | OpenEye OEToolkits 1.7.0 | c1ccc(cc1)c2nc(on2)[C@@H](c3ccccc3)Oc4cccc5c4cc(s5)C(N)N | OpenEye OEToolkits 1.7.0 | c1ccc(cc1)c2nc(on2)C(c3ccccc3)Oc4cccc5c4cc(s5)C(N)N | CACTVS 3.352 | NC(N)c1sc2cccc(O[C@@H](c3onc(n3)c4ccccc4)c5ccccc5)c2c1 |
|
Formula | C24 H20 N4 O2 S |
Name | 1-{4-[(R)-phenyl(3-phenyl-1,2,4-oxadiazol-5-yl)methoxy]-1-benzothiophen-2-yl}methanediamine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058661034
|
PDB chain | 3lc5 Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|