Structure of PDB 3lbg Chain A Binding Site BS02 |
|
|
Ligand ID | 8TX |
InChI | InChI=1S/C5H4N4O2S/c10-3-1-2(7-4(11)9-3)8-5(12)6-1/h(H4,6,7,8,9,10,11,12) |
InChIKey | KFQXXACDWBTCDT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | O=C1NC(=O)C2=C(N1)NC(=S)N2 | OpenEye OEToolkits 1.7.0 | C12=C(NC(=O)NC1=O)NC(=S)N2 |
|
Formula | C5 H4 N4 O2 S |
Name | 8-thioxo-3,7,8,9-tetrahydro-1H-purine-2,6-dione |
ChEMBL | CHEMBL1230639 |
DrugBank | |
ZINC | ZINC000013543258
|
PDB chain | 3lbg Chain A Residue 297
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|