Structure of PDB 3ki0 Chain A Binding Site BS02 |
|
|
Ligand ID | G9D |
InChI | InChI=1S/C15H16N4O2/c20-15-10-2-1-3-12-14(10)11(8-16-12)13(17-18-15)9-19-4-6-21-7-5-19/h1-3,8,16H,4-7,9H2,(H,18,20) |
InChIKey | VLZMFVRHOYPDFA-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | c1cc2c3c(c1)[nH]cc3C(=NNC2=O)CN4CCOCC4 | CACTVS 3.352 | O=C1NN=C(CN2CCOCC2)c3c[nH]c4cccc1c34 |
|
Formula | C15 H16 N4 O2 |
Name | 3-(morpholin-4-ylmethyl)-1,5-dihydro-6H-[1,2]diazepino[4,5,6-cd]indol-6-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058638448
|
PDB chain | 3ki0 Chain A Residue 635
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
E581 |
Catalytic site (residue number reindexed from 1) |
E152 |
Enzyme Commision number |
2.4.2.36: NAD(+)--diphthamide ADP-ribosyltransferase. |
|
|
|