Structure of PDB 3k3b Chain A Binding Site BS02 |
|
|
Ligand ID | L31 |
InChI | InChI=1S/C20H20N2O2/c1-12-6-7-18-17(10-12)16-8-9-22(13(2)23)20(19(16)21-18)14-4-3-5-15(24)11-14/h3-7,10-11,20-21,24H,8-9H2,1-2H3/t20-/m1/s1 |
InChIKey | ZNGGYWGHJZJJDR-HXUWFJFHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | Cc1ccc2c(c1)c3c([nH]2)C(N(CC3)C(=O)C)c4cccc(c4)O | OpenEye OEToolkits 1.7.0 | Cc1ccc2c(c1)c3c([nH]2)[C@H](N(CC3)C(=O)C)c4cccc(c4)O | ACDLabs 11.02 | O=C(N4CCc2c1cc(ccc1nc2C4c3cccc(O)c3)C)C | CACTVS 3.352 | CC(=O)N1CCc2c([nH]c3ccc(C)cc23)[C@H]1c4cccc(O)c4 | CACTVS 3.352 | CC(=O)N1CCc2c([nH]c3ccc(C)cc23)[CH]1c4cccc(O)c4 |
|
Formula | C20 H20 N2 O2 |
Name | 3-[(1R)-2-acetyl-6-methyl-2,3,4,9-tetrahydro-1H-beta-carbolin-1-yl]phenol |
ChEMBL | |
DrugBank | |
ZINC | ZINC000045337234
|
PDB chain | 3k3b Chain A Residue 371
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|