Structure of PDB 3k2x Chain A Binding Site BS02 |
|
|
Ligand ID | I5A |
InChI | InChI=1S/C9H12IN3O4/c10-3-4-6(14)7(15)8(17-4)13-2-1-5(11)12-9(13)16/h1-2,4,6-8,14-15H,3H2,(H2,11,12,16)/t4-,6-,7-,8-/m1/s1 |
InChIKey | ZFSSJWRSRMQVTI-XVFCMESISA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | C1=CN(C(=O)N=C1N)[C@H]2[C@@H]([C@@H]([C@H](O2)CI)O)O | ACDLabs 11.02 | O=C1N=C(N)C=CN1C2OC(C(O)C2O)CI | OpenEye OEToolkits 1.7.0 | C1=CN(C(=O)N=C1N)C2C(C(C(O2)CI)O)O | CACTVS 3.352 | NC1=NC(=O)N(C=C1)[CH]2O[CH](CI)[CH](O)[CH]2O | CACTVS 3.352 | NC1=NC(=O)N(C=C1)[C@@H]2O[C@H](CI)[C@@H](O)[C@H]2O |
|
Formula | C9 H12 I N3 O4 |
Name | 5'-deoxy-5'-iodocytidine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058633354
|
PDB chain | 3k2x Chain A Residue 164
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
4.6.1.12: 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase. |
|
|
|