Structure of PDB 3jsw Chain A Binding Site BS02 |
|
|
Ligand ID | JAR |
InChI | InChI=1S/C20H25N5O/c1-13(2)25-19-16(9-21-25)20(26)23-18(22-19)17-12-24(10-14(17)3)11-15-7-5-4-6-8-15/h4-9,13-14,17H,10-12H2,1-3H3,(H,22,23,26)/t14-,17-/m1/s1 |
InChIKey | PUGMRQMXTZPAIZ-RHSMWYFYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | CC(C)n1ncc2C(=O)NC(=Nc12)[C@@H]3CN(C[C@H]3C)Cc4ccccc4 | OpenEye OEToolkits 1.7.0 | C[C@@H]1C[N@@](C[C@H]1C2=Nc3c(cnn3C(C)C)C(=O)N2)Cc4ccccc4 | CACTVS 3.352 | CC(C)n1ncc2C(=O)NC(=Nc12)[CH]3CN(C[CH]3C)Cc4ccccc4 | ACDLabs 11.02 | O=C1NC(=Nc2c1cnn2C(C)C)C4C(C)CN(Cc3ccccc3)C4 | OpenEye OEToolkits 1.7.0 | CC1CN(CC1C2=Nc3c(cnn3C(C)C)C(=O)N2)Cc4ccccc4 |
|
Formula | C20 H25 N5 O |
Name | 6-[(3S,4S)-1-benzyl-4-methylpyrrolidin-3-yl]-1-(1-methylethyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one |
ChEMBL | CHEMBL572517 |
DrugBank | |
ZINC | ZINC000044713305
|
PDB chain | 3jsw Chain A Residue 900
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.4.35: 3',5'-cyclic-GMP phosphodiesterase. |
|
|
|