Structure of PDB 3jsi Chain A Binding Site BS02 |
|
|
Ligand ID | WTC |
InChI | InChI=1S/C17H18N4O/c22-17-14-11-18-21(13-8-4-5-9-13)16(14)19-15(20-17)10-12-6-2-1-3-7-12/h1-3,6-7,11,13H,4-5,8-10H2,(H,19,20,22) |
InChIKey | FVOYQCUKGQGDKH-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | O=C1NC(=Nc2n(ncc12)C3CCCC3)Cc4ccccc4 | OpenEye OEToolkits 1.7.0 | c1ccc(cc1)CC2=Nc3c(cnn3C4CCCC4)C(=O)N2 | ACDLabs 11.02 | O=C1NC(=Nc2c1cnn2C3CCCC3)Cc4ccccc4 |
|
Formula | C17 H18 N4 O |
Name | 6-benzyl-1-cyclopentyl-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one |
ChEMBL | CHEMBL572934 |
DrugBank | |
ZINC | ZINC000044713071
|
PDB chain | 3jsi Chain A Residue 903
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.4.35: 3',5'-cyclic-GMP phosphodiesterase. |
|
|
|