Structure of PDB 3ips Chain A Binding Site BS02 |
|
|
Ligand ID | O90 |
InChI | InChI=1S/C22H21ClF3NO4S/c1-2-4-14-17(7-6-15-20(14)31-27-21(15)22(24,25)26)30-9-3-10-32-18-8-5-13(11-16(18)23)12-19(28)29/h5-8,11H,2-4,9-10,12H2,1H3,(H,28,29) |
InChIKey | TZBRFAASYWFUGK-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 11.02 | O=C(O)Cc3ccc(SCCCOc2ccc1c(onc1C(F)(F)F)c2CCC)c(Cl)c3 | CACTVS 3.352 | CCCc1c(OCCCSc2ccc(CC(O)=O)cc2Cl)ccc3c1onc3C(F)(F)F | OpenEye OEToolkits 1.7.0 | CCCc1c(ccc2c1onc2C(F)(F)F)OCCCSc3ccc(cc3Cl)CC(=O)O |
|
Formula | C22 H21 Cl F3 N O4 S |
Name | {3-chloro-4-[(3-{[7-propyl-3-(trifluoromethyl)-1,2-benzisoxazol-6-yl]oxy}propyl)sulfanyl]phenyl}acetic acid |
ChEMBL | CHEMBL23296 |
DrugBank | |
ZINC | ZINC000003834054
|
PDB chain | 3ips Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|