Structure of PDB 3igp Chain A Binding Site BS02 |
|
|
Ligand ID | DT7 |
InChI | InChI=1S/C11H16N2O4S/c1-16-10-5-8-3-4-13(18(12,14)15)7-9(8)6-11(10)17-2/h5-6H,3-4,7H2,1-2H3,(H2,12,14,15) |
InChIKey | YDCHIXAESCPAOW-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | COc1cc2CCN(Cc2cc1OC)[S](N)(=O)=O | OpenEye OEToolkits 1.7.0 | COc1cc2c(cc1OC)CN(CC2)S(=O)(=O)N | OpenEye OEToolkits 1.7.0 | COc1cc2c(cc1OC)C[N@@](CC2)S(=O)(=O)N | ACDLabs 11.02 | O=S(=O)(N)N2Cc1c(cc(OC)c(OC)c1)CC2 |
|
Formula | C11 H16 N2 O4 S |
Name | 6,7-dimethoxy-3,4-dihydroisoquinoline-2(1H)-sulfonamide |
ChEMBL | CHEMBL1089044 |
DrugBank | |
ZINC | ZINC000036924410
|
PDB chain | 3igp Chain A Residue 263
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|