Structure of PDB 3ibn Chain A Binding Site BS02 |
|
|
Ligand ID | O60 |
InChI | InChI=1S/C10H24N2O6S2/c11-19(13,14)17-9-7-5-3-1-2-4-6-8-10-18-20(12,15)16/h1-10H2,(H2,11,13,14)(H2,12,15,16) |
InChIKey | XPDWKENHTJHZSC-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | N[S](=O)(=O)OCCCCCCCCCCO[S](N)(=O)=O | ACDLabs 11.02 | O=S(=O)(OCCCCCCCCCCOS(=O)(=O)N)N | OpenEye OEToolkits 1.7.0 | C(CCCCCOS(=O)(=O)N)CCCCOS(=O)(=O)N |
|
Formula | C10 H24 N2 O6 S2 |
Name | decane-1,10-diyl disulfamate; 1,10-decanediol disulfamate |
ChEMBL | CHEMBL171476 |
DrugBank | |
ZINC |
|
PDB chain | 3ibn Chain A Residue 300
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|