Structure of PDB 3ibl Chain A Binding Site BS02 |
|
|
Ligand ID | O59 |
InChI | InChI=1S/C8H20N2O6S2/c9-17(11,12)15-7-5-3-1-2-4-6-8-16-18(10,13)14/h1-8H2,(H2,9,11,12)(H2,10,13,14) |
InChIKey | IPTXSYCLIWBHBX-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 11.02 | O=S(=O)(OCCCCCCCCOS(=O)(=O)N)N | OpenEye OEToolkits 1.7.0 | C(CCCCOS(=O)(=O)N)CCCOS(=O)(=O)N | CACTVS 3.352 | N[S](=O)(=O)OCCCCCCCCO[S](N)(=O)=O |
|
Formula | C8 H20 N2 O6 S2 |
Name | octane-1,8-diyl disulfamate; 1,8-Octanediol disulfamate |
ChEMBL | CHEMBL182455 |
DrugBank | |
ZINC | ZINC000028358893
|
PDB chain | 3ibl Chain A Residue 300
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|