Structure of PDB 3i8v Chain A Binding Site BS02 |
|
|
Ligand ID | 0MO |
InChI | InChI=1S/C15H22N2O3/c1-3-4-7-20-14-9-11(5-6-13(14)19-2)8-12-10-16-15(18)17-12/h5-6,9,12H,3-4,7-8,10H2,1-2H3,(H2,16,17,18)/t12-/m1/s1 |
InChIKey | PDMUULPVBYQBBK-GFCCVEGCSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | CCCCOc1cc(C[CH]2CNC(=O)N2)ccc1OC | CACTVS 3.352 | CCCCOc1cc(C[C@@H]2CNC(=O)N2)ccc1OC | ACDLabs 11.02 | O=C1NCC(N1)Cc2cc(OCCCC)c(OC)cc2 | OpenEye OEToolkits 1.7.0 | CCCCOc1cc(ccc1OC)CC2CNC(=O)N2 | OpenEye OEToolkits 1.7.0 | CCCCOc1cc(ccc1OC)C[C@@H]2CNC(=O)N2 |
|
Formula | C15 H22 N2 O3 |
Name | (4R)-4-(3-butoxy-4-methoxybenzyl)imidazolidin-2-one; 4-(3-butoxy-4-methoxyphenyl)methyl-2-imidazolidone |
ChEMBL | CHEMBL1229585 |
DrugBank | DB06842 |
ZINC | ZINC000002011308
|
PDB chain | 3i8v Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.1.4.53: 3',5'-cyclic-AMP phosphodiesterase. |
|
|
|