Structure of PDB 3i1u Chain A Binding Site BS02 |
|
|
Ligand ID | BTW |
InChI | InChI=1S/C11H14O2S/c1-8(14)10(11(12)13)7-9-5-3-2-4-6-9/h2-6,8,10,14H,7H2,1H3,(H,12,13)/t8-,10-/m1/s1 |
InChIKey | LYLMADGMEFUMHJ-PSASIEDQSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CC(C(Cc1ccccc1)C(=O)O)S | CACTVS 3.341 | C[CH](S)[CH](Cc1ccccc1)C(O)=O | ACDLabs 10.04 | O=C(O)C(C(S)C)Cc1ccccc1 | OpenEye OEToolkits 1.5.0 | C[C@H]([C@@H](Cc1ccccc1)C(=O)O)S | CACTVS 3.341 | C[C@@H](S)[C@@H](Cc1ccccc1)C(O)=O |
|
Formula | C11 H14 O2 S |
Name | (2S,3R)-2-benzyl-3-sulfanylbutanoic acid; (2S,3R)-2-benzyl-3-mercaptobutanoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058626914
|
PDB chain | 3i1u Chain A Residue 402
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|