Structure of PDB 3hp1 Chain A Binding Site BS02 |
|
|
Ligand ID | LLT |
InChI | InChI=1S/C10H14N2O5/c1-5-3-12(10(16)11-9(5)15)8-2-6(14)7(4-13)17-8/h3,6-8,13-14H,2,4H2,1H3,(H,11,15,16)/t6-,7+,8+/m1/s1 |
InChIKey | IQFYYKKMVGJFEH-CSMHCCOUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CC1=CN(C(=O)NC1=O)C2CC(C(O2)CO)O | CACTVS 3.341 | CC1=CN([CH]2C[CH](O)[CH](CO)O2)C(=O)NC1=O | ACDLabs 10.04 | O=C1NC(=O)N(C=C1C)C2OC(C(O)C2)CO | CACTVS 3.341 | CC1=CN([C@@H]2C[C@@H](O)[C@H](CO)O2)C(=O)NC1=O | OpenEye OEToolkits 1.5.0 | CC1=CN(C(=O)NC1=O)[C@@H]2C[C@H]([C@@H](O2)CO)O |
|
Formula | C10 H14 N2 O5 |
Name | L-deoxythymidine; L-thymidine; beta-L-thymidine; L-dT; 2'-deoxy-L-thymidine; 1-(2-deoxy-beta-L-erythro-pentofuranosyl)-5-methylpyrimidine-2,4(1H,3H)-dione |
ChEMBL | CHEMBL374731 |
DrugBank | DB01265 |
ZINC | ZINC000000002159
|
PDB chain | 3hp1 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
E53 R128 |
Catalytic site (residue number reindexed from 1) |
E34 R94 |
Enzyme Commision number |
2.7.1.113: deoxyguanosine kinase. 2.7.1.74: deoxycytidine kinase. 2.7.1.76: deoxyadenosine kinase. |
|
|
|