Structure of PDB 3hm8 Chain A Binding Site BS02 |
|
|
Ligand ID | BG6 |
InChI | InChI=1S/C6H13O9P/c7-3-2(1-14-16(11,12)13)15-6(10)5(9)4(3)8/h2-10H,1H2,(H2,11,12,13)/t2-,3-,4+,5-,6-/m1/s1 |
InChIKey | NBSCHQHZLSJFNQ-VFUOTHLCSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | O[CH]1O[CH](CO[P](O)(O)=O)[CH](O)[CH](O)[CH]1O | OpenEye OEToolkits 1.5.0 | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)O)O)O)OP(=O)(O)O | CACTVS 3.341 | O[C@@H]1O[C@H](CO[P](O)(O)=O)[C@@H](O)[C@H](O)[C@H]1O | OpenEye OEToolkits 1.5.0 | C(C1C(C(C(C(O1)O)O)O)O)OP(=O)(O)O | ACDLabs 10.04 | O=P(O)(O)OCC1OC(O)C(O)C(O)C1O |
|
Formula | C6 H13 O9 P |
Name | 6-O-phosphono-beta-D-glucopyranose; BETA-D-GLUCOSE-6-PHOSPHATE; 6-O-phosphono-beta-D-glucose; 6-O-phosphono-D-glucose; 6-O-phosphono-glucose |
ChEMBL | CHEMBL257975 |
DrugBank | DB04122 |
ZINC | ZINC000003875374
|
PDB chain | 3hm8 Chain A Residue 1002
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|