Structure of PDB 3hf8 Chain A Binding Site BS02 |
|
|
Ligand ID | ML0 |
InChI | InChI=1S/C27H22F4N4O3/c28-20-3-1-2-19(13-20)16-8-10-18(11-9-16)24(27(29,30)31)38-23-14-22(34-26(33)35-23)17-6-4-15(5-7-17)12-21(32)25(36)37/h1-11,13-14,21,24H,12,32H2,(H,36,37)(H2,33,34,35)/t21-,24+/m0/s1 |
InChIKey | JZWUKILTKYJLCN-XUZZJYLKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | c1cc(cc(c1)F)c2ccc(cc2)[C@H](C(F)(F)F)Oc3cc(nc(n3)N)c4ccc(cc4)C[C@@H](C(=O)O)N | OpenEye OEToolkits 1.5.0 | c1cc(cc(c1)F)c2ccc(cc2)C(C(F)(F)F)Oc3cc(nc(n3)N)c4ccc(cc4)CC(C(=O)O)N | CACTVS 3.341 | N[CH](Cc1ccc(cc1)c2cc(O[CH](c3ccc(cc3)c4cccc(F)c4)C(F)(F)F)nc(N)n2)C(O)=O | ACDLabs 10.04 | Fc1cccc(c1)c2ccc(cc2)C(Oc4nc(nc(c3ccc(cc3)CC(C(=O)O)N)c4)N)C(F)(F)F | CACTVS 3.341 | N[C@@H](Cc1ccc(cc1)c2cc(O[C@H](c3ccc(cc3)c4cccc(F)c4)C(F)(F)F)nc(N)n2)C(O)=O |
|
Formula | C27 H22 F4 N4 O3 |
Name | 4-{2-amino-6-[(1R)-2,2,2-trifluoro-1-(3'-fluorobiphenyl-4-yl)ethoxy]pyrimidin-4-yl}-L-phenylalanine; (S)-2-Amino-3-(4-{2-amino-6-[(S)-1-(3'-fluoro-biphenyl-4-yl)-ethoxy]-pyrimidin-4-yl}-phenyl)-propionic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000042852084
|
PDB chain | 3hf8 Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
Molecular Function |
GO:0004497 |
monooxygenase activity |
GO:0005506 |
iron ion binding |
GO:0016714 |
oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen |
|
|